C28H61N3O6+2 — CID 161001261
3-[[2-(2-ethoxyethoxy)acetyl]amino]propyl-[4-[[6-(2-ethoxyethoxy)-5-oxohexyl]-dimethylazaniumyl]butyl]-dimethylazanium;methane (PubChem CID 161001261) has the molecular formula C28H61N3O6+2 and a molecular weight of 535.81 g/mol. Its IUPAC name is 3-[[2-(2-ethoxyethoxy)acetyl]amino]propyl-[4-[[6-(2-ethoxyethoxy)-5-oxohexyl]-dimethylazaniumyl]butyl]-dimethylazanium;methane.
| Compound Name | 3-[[2-(2-ethoxyethoxy)acetyl]amino]propyl-[4-[[6-(2-ethoxyethoxy)-5-oxohexyl]-dimethylazaniumyl]butyl]-dimethylazanium;methane |
|---|---|
| PubChem CID | 161001261 |
| Molecular Formula | C28H61N3O6+2 |
| Molecular Weight | 535.81 g/mol |
| Exact Mass | 535.45 |
| IUPAC Name | 3-[[2-(2-ethoxyethoxy)acetyl]amino]propyl-[4-[[6-(2-ethoxyethoxy)-5-oxohexyl]-dimethylazaniumyl]butyl]-dimethylazanium;methane |
| SMILES | C.CCOCCOCC(=O)CCCC[N+](C)(C)CCCC[N+](C)(C)CCCNC(=O)COCCOCC |
| InChI | InChI=1S/C27H56N3O6.CH4/c1-7-33-20-22-35-24-26(31)14-9-10-16-29(3,4)17-11-12-18-30(5,6)19-13-15-28-27(32)25-36-23-21-34-8-2;/h7-25H2,1-6H3;1H4/q+1;/p+1 |
| InChIKey | KQQULJAQBMYVAQ-UHFFFAOYSA-O |
| XLogP | 2.91 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.81 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|