C11H21F3N2O4S — CID 140799766
4-[dimethyl-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azaniumyl]butane-2-sulfonate (PubChem CID 140799766) has the molecular formula C11H21F3N2O4S and a molecular weight of 334.36 g/mol. Its IUPAC name is 4-[dimethyl-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azaniumyl]butane-2-sulfonate.
| Compound Name | 4-[dimethyl-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azaniumyl]butane-2-sulfonate |
|---|---|
| PubChem CID | 140799766 |
| Molecular Formula | C11H21F3N2O4S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 4-[dimethyl-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azaniumyl]butane-2-sulfonate |
| SMILES | CC(CC[N+](C)(C)CCCNC(=O)C(F)(F)F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C11H21F3N2O4S/c1-9(21(18,19)20)5-8-16(2,3)7-4-6-15-10(17)11(12,13)14/h9H,4-8H2,1-3H3,(H-,15,17,18,19,20) |
| InChIKey | MOPXYOJZYJNDMI-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|