C22H42F3N4O5+ — CID 10210325
methyl-bis[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azanium (PubChem CID 10210325) has the molecular formula C22H42F3N4O5+ and a molecular weight of 499.60 g/mol. Its IUPAC name is methyl-bis[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azanium.
| Compound Name | methyl-bis[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azanium |
|---|---|
| PubChem CID | 10210325 |
| Molecular Formula | C22H42F3N4O5+ |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | methyl-bis[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-[3-[(2,2,2-trifluoroacetyl)amino]propyl]azanium |
| SMILES | CC(C)(C)OC(=O)NCCC[N+](C)(CCCNC(=O)OC(C)(C)C)CCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C22H41F3N4O5/c1-20(2,3)33-18(31)27-12-9-15-29(7,14-8-11-26-17(30)22(23,24)25)16-10-13-28-19(32)34-21(4,5)6/h8-16H2,1-7H3,(H2-,26,27,28,30,31,32)/p+1 |
| InChIKey | UAYSEKLGEPTSEF-UHFFFAOYSA-O |
| XLogP | 3.33 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|