C23H44F3N4O4+ — CID 58761785
methyl-bis[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-[3-(3,3,3-trifluoroprop-1-en-2-ylamino)propyl]azanium (PubChem CID 58761785) has the molecular formula C23H44F3N4O4+ and a molecular weight of 497.62 g/mol. Its IUPAC name is methyl-bis[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-[3-(3,3,3-trifluoroprop-1-en-2-ylamino)propyl]azanium.
| Compound Name | methyl-bis[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-[3-(3,3,3-trifluoroprop-1-en-2-ylamino)propyl]azanium |
|---|---|
| PubChem CID | 58761785 |
| Molecular Formula | C23H44F3N4O4+ |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.33 |
| IUPAC Name | methyl-bis[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-[3-(3,3,3-trifluoroprop-1-en-2-ylamino)propyl]azanium |
| SMILES | C=C(NCCC[N+](C)(CCCNC(=O)OC(C)(C)C)CCCNC(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C23H43F3N4O4/c1-18(23(24,25)26)27-12-9-15-30(8,16-10-13-28-19(31)33-21(2,3)4)17-11-14-29-20(32)34-22(5,6)7/h27H,1,9-17H2,2-8H3,(H-,28,29,31,32)/p+1 |
| InChIKey | HGKXXPLCPPDNCV-UHFFFAOYSA-O |
| XLogP | 4.32 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|