C23H49N2O6+ — CID 166474376
3-carboxypropyl-methyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]azanium;ethane (PubChem CID 166474376) has the molecular formula C23H49N2O6+ and a molecular weight of 449.65 g/mol. Its IUPAC name is 3-carboxypropyl-methyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]azanium;ethane.
| Compound Name | 3-carboxypropyl-methyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]azanium;ethane |
|---|---|
| PubChem CID | 166474376 |
| Molecular Formula | C23H49N2O6+ |
| Molecular Weight | 449.65 g/mol |
| Exact Mass | 449.36 |
| IUPAC Name | 3-carboxypropyl-methyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]azanium;ethane |
| SMILES | CC.CC.CC(C)(C)OC(=O)C[N+](C)(CCCNC(=O)OC(C)(C)C)CCCC(=O)O |
| InChI | InChI=1S/C19H36N2O6.2C2H6/c1-18(2,3)26-16(24)14-21(7,12-8-10-15(22)23)13-9-11-20-17(25)27-19(4,5)6;2*1-2/h8-14H2,1-7H3,(H-,20,22,23,25);2*1-2H3/p+1 |
| InChIKey | BYUCVQVXJLETQE-UHFFFAOYSA-O |
| XLogP | 4.61 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|