C18H42N4O2+2 — CID 57143385
3-aminopropyl-[3-[dimethyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]azaniumyl]propyl]-dimethylazanium (PubChem CID 57143385) has the molecular formula C18H42N4O2+2 and a molecular weight of 346.56 g/mol. Its IUPAC name is 3-aminopropyl-[3-[dimethyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]azaniumyl]propyl]-dimethylazanium.
| Compound Name | 3-aminopropyl-[3-[dimethyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]azaniumyl]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 57143385 |
| Molecular Formula | C18H42N4O2+2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.33 |
| IUPAC Name | 3-aminopropyl-[3-[dimethyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]azaniumyl]propyl]-dimethylazanium |
| SMILES | CC(C)(C)OC(=O)NCCC[N+](C)(C)CCC[N+](C)(C)CCCN |
| InChI | InChI=1S/C18H41N4O2/c1-18(2,3)24-17(23)20-12-9-14-22(6,7)16-10-15-21(4,5)13-8-11-19/h8-16,19H2,1-7H3/q+1/p+1 |
| InChIKey | IWWISCVPCNWAOG-UHFFFAOYSA-O |
| XLogP | 1.79 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|