C11H21F3N2O4S — CID 141480561
ethyl-dimethyl-[3-(prop-2-enoylamino)propyl]azanium;trifluoromethanesulfonate (PubChem CID 141480561) has the molecular formula C11H21F3N2O4S and a molecular weight of 334.36 g/mol. Its IUPAC name is ethyl-dimethyl-[3-(prop-2-enoylamino)propyl]azanium;trifluoromethanesulfonate.
| Compound Name | ethyl-dimethyl-[3-(prop-2-enoylamino)propyl]azanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 141480561 |
| Molecular Formula | C11H21F3N2O4S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | ethyl-dimethyl-[3-(prop-2-enoylamino)propyl]azanium;trifluoromethanesulfonate |
| SMILES | C=CC(=O)NCCC[N+](C)(C)CC.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C10H20N2O.CHF3O3S/c1-5-10(13)11-8-7-9-12(3,4)6-2;2-1(3,4)8(5,6)7/h5H,1,6-9H2,2-4H3;(H,5,6,7) |
| InChIKey | YVOPDFOXBREABH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|