C17H34N2O6S — CID 123269102
3-[3-[(4-carboxy-2,2,4-trimethylpentanoyl)amino]propyl-dimethylazaniumyl]propane-1-sulfonate (PubChem CID 123269102) has the molecular formula C17H34N2O6S and a molecular weight of 394.53 g/mol. Its IUPAC name is 3-[3-[(4-carboxy-2,2,4-trimethylpentanoyl)amino]propyl-dimethylazaniumyl]propane-1-sulfonate.
| Compound Name | 3-[3-[(4-carboxy-2,2,4-trimethylpentanoyl)amino]propyl-dimethylazaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 123269102 |
| Molecular Formula | C17H34N2O6S |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 3-[3-[(4-carboxy-2,2,4-trimethylpentanoyl)amino]propyl-dimethylazaniumyl]propane-1-sulfonate |
| SMILES | CC(C)(CC(C)(C)C(=O)NCCC[N+](C)(C)CCCS(=O)(=O)[O-])C(=O)O |
| InChI | InChI=1S/C17H34N2O6S/c1-16(2,13-17(3,4)15(21)22)14(20)18-9-7-10-19(5,6)11-8-12-26(23,24)25/h7-13H2,1-6H3,(H2-,18,20,21,22,23,24,25) |
| InChIKey | VRODAKLYHZCZRV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|