C18H39N2O+ — CID 91040759
butyl-dimethyl-[3-(2,2,4,4-tetramethylpentanoylamino)propyl]azanium (PubChem CID 91040759) has the molecular formula C18H39N2O+ and a molecular weight of 299.52 g/mol. Its IUPAC name is butyl-dimethyl-[3-(2,2,4,4-tetramethylpentanoylamino)propyl]azanium.
| Compound Name | butyl-dimethyl-[3-(2,2,4,4-tetramethylpentanoylamino)propyl]azanium |
|---|---|
| PubChem CID | 91040759 |
| Molecular Formula | C18H39N2O+ |
| Molecular Weight | 299.52 g/mol |
| Exact Mass | 299.31 |
| IUPAC Name | butyl-dimethyl-[3-(2,2,4,4-tetramethylpentanoylamino)propyl]azanium |
| SMILES | CCCC[N+](C)(C)CCCNC(=O)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C18H38N2O/c1-9-10-13-20(7,8)14-11-12-19-16(21)18(5,6)15-17(2,3)4/h9-15H2,1-8H3/p+1 |
| InChIKey | VOBYNQXOQXPZEM-UHFFFAOYSA-O |
| XLogP | 3.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|