C25H49N2O3+ — CID 145481720
carboxymethyl-dimethyl-[3-[[(Z)-2,2,4,4,7,7,9,9-octamethyldec-5-enoyl]amino]propyl]azanium (PubChem CID 145481720) has the molecular formula C25H49N2O3+ and a molecular weight of 425.68 g/mol. Its IUPAC name is carboxymethyl-dimethyl-[3-[[(Z)-2,2,4,4,7,7,9,9-octamethyldec-5-enoyl]amino]propyl]azanium.
| Compound Name | carboxymethyl-dimethyl-[3-[[(Z)-2,2,4,4,7,7,9,9-octamethyldec-5-enoyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 145481720 |
| Molecular Formula | C25H49N2O3+ |
| Molecular Weight | 425.68 g/mol |
| Exact Mass | 425.37 |
| IUPAC Name | carboxymethyl-dimethyl-[3-[[(Z)-2,2,4,4,7,7,9,9-octamethyldec-5-enoyl]amino]propyl]azanium |
| SMILES | CC(C)(C)CC(C)(C)/C=C\C(C)(C)CC(C)(C)C(=O)NCCC[N+](C)(C)CC(=O)O |
| InChI | InChI=1S/C25H48N2O3/c1-22(2,3)18-23(4,5)13-14-24(6,7)19-25(8,9)21(30)26-15-12-16-27(10,11)17-20(28)29/h13-14H,12,15-19H2,1-11H3,(H-,26,28,29,30)/p+1/b14-13- |
| InChIKey | SFNHXRCQGNZIDO-YPKPFQOOSA-O |
| XLogP | 5.11 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.68 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|