C18H34O2 — CID 88560041
(Z)-2,2,4,4,7,7,9,9-octamethyldec-5-enoic acid (PubChem CID 88560041) has the molecular formula C18H34O2 and a molecular weight of 282.47 g/mol. Its IUPAC name is (Z)-2,2,4,4,7,7,9,9-octamethyldec-5-enoic acid.
| Compound Name | (Z)-2,2,4,4,7,7,9,9-octamethyldec-5-enoic acid |
|---|---|
| PubChem CID | 88560041 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | (Z)-2,2,4,4,7,7,9,9-octamethyldec-5-enoic acid |
| SMILES | CC(C)(C)CC(C)(C)/C=C\C(C)(C)CC(C)(C)C(=O)O |
| InChI | InChI=1S/C18H34O2/c1-15(2,3)12-16(4,5)10-11-17(6,7)13-18(8,9)14(19)20/h10-11H,12-13H2,1-9H3,(H,19,20)/b11-10- |
| InChIKey | OWARQUMYWBHFPQ-KHPPLWFESA-N |
| XLogP | 5.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|