C9H18O2 — CID 118042012
2,4,4-trimethyl-2-(trideuteriomethyl)pentanoic acid (PubChem CID 118042012) has the molecular formula C9H18O2 and a molecular weight of 161.26 g/mol. Its IUPAC name is 2,4,4-trimethyl-2-(trideuteriomethyl)pentanoic acid.
| Compound Name | 2,4,4-trimethyl-2-(trideuteriomethyl)pentanoic acid |
|---|---|
| PubChem CID | 118042012 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 161.26 g/mol |
| Exact Mass | 161.15 |
| IUPAC Name | 2,4,4-trimethyl-2-(trideuteriomethyl)pentanoic acid |
| SMILES | [2H]C([2H])([2H])C(C)(CC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C9H18O2/c1-8(2,3)6-9(4,5)7(10)11/h6H2,1-5H3,(H,10,11)/i4D3 |
| InChIKey | UDILKAAYNUPREE-GKOSEXJESA-N |
| XLogP | 2.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |