About 2,2-dimethyl-4-oxo-4-(trimethyl-λ4-sulfanyl)butanoic acid
2,2-dimethyl-4-oxo-4-(trimethyl-λ4-sulfanyl)butanoic acid (PubChem CID 123815802) has the molecular formula C9H18O3S
and a molecular weight of 206.31 g/mol. Its IUPAC name is 2,2-dimethyl-4-oxo-4-(trimethyl-λ4-sulfanyl)butanoic acid.
Molecular Properties
| Compound Name | 2,2-dimethyl-4-oxo-4-(trimethyl-λ4-sulfanyl)butanoic acid |
| PubChem CID | 123815802 |
| Molecular Formula | C9H18O3S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 2,2-dimethyl-4-oxo-4-(trimethyl-λ4-sulfanyl)butanoic acid |
| SMILES | CC(C)(CC(=O)S(C)(C)C)C(=O)O |
| InChI | InChI=1S/C9H18O3S/c1-9(2,8(11)12)6-7(10)13(3,4)5/h6H2,1-5H3,(H,11,12) |
| InChIKey | YJLVKBIEFOCSIG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-4-oxo-4-(trimethyl-λ4-sulfanyl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-4-oxo-4-(trimethyl-λ4-sulfanyl)butanoic acid?
The IUPAC name of 2,2-dimethyl-4-oxo-4-(trimethyl-λ4-sulfanyl)butanoic acid (CID 123815802) is 2,2-dimethyl-4-oxo-4-(trimethyl-λ4-sulfanyl)butanoic acid.
What is the SMILES notation for 2,2-dimethyl-4-oxo-4-(trimethyl-λ4-sulfanyl)butanoic acid?
The canonical SMILES for 2,2-dimethyl-4-oxo-4-(trimethyl-λ4-sulfanyl)butanoic acid is CC(C)(CC(=O)S(C)(C)C)C(=O)O.
What is the InChIKey of 2,2-dimethyl-4-oxo-4-(trimethyl-λ4-sulfanyl)butanoic acid?
The InChIKey is YJLVKBIEFOCSIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O3S/c1-9(2,8(11)12)6-7(10)13(3,4)5/h6H2,1-5H3,(H,11,12).
What are the key properties of 2,2-dimethyl-4-oxo-4-(trimethyl-λ4-sulfanyl)butanoic acid?
2,2-dimethyl-4-oxo-4-(trimethyl-λ4-sulfanyl)butanoic acid has a molecular weight of 206.31 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-4-oxo-4-(trimethyl-λ4-sulfanyl)butanoic acid is sourced from PubChem (CID 123815802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).