About 4-[bis(2-hydroxyethyl)amino]-2,2-dimethyl-4-oxobutanoic acid
4-[bis(2-hydroxyethyl)amino]-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 65302623) has the molecular formula C10H19NO5
and a molecular weight of 233.26 g/mol. Its IUPAC name is 4-[bis(2-hydroxyethyl)amino]-2,2-dimethyl-4-oxobutanoic acid.
Analyze 4-[bis(2-hydroxyethyl)amino]-2,2-dimethyl-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[bis(2-hydroxyethyl)amino]-2,2-dimethyl-4-oxobutanoic acid?
The IUPAC name of 4-[bis(2-hydroxyethyl)amino]-2,2-dimethyl-4-oxobutanoic acid (CID 65302623) is 4-[bis(2-hydroxyethyl)amino]-2,2-dimethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-[bis(2-hydroxyethyl)amino]-2,2-dimethyl-4-oxobutanoic acid?
The canonical SMILES for 4-[bis(2-hydroxyethyl)amino]-2,2-dimethyl-4-oxobutanoic acid is CC(C)(CC(=O)N(CCO)CCO)C(=O)O.
What is the InChIKey of 4-[bis(2-hydroxyethyl)amino]-2,2-dimethyl-4-oxobutanoic acid?
The InChIKey is ARHGPCRWFQQEPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO5/c1-10(2,9(15)16)7-8(14)11(3-5-12)4-6-13/h12-13H,3-7H2,1-2H3,(H,15,16).
What are the key properties of 4-[bis(2-hydroxyethyl)amino]-2,2-dimethyl-4-oxobutanoic acid?
4-[bis(2-hydroxyethyl)amino]-2,2-dimethyl-4-oxobutanoic acid has a molecular weight of 233.26 g/mol, XLogP of -0.70, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[bis(2-hydroxyethyl)amino]-2,2-dimethyl-4-oxobutanoic acid is sourced from PubChem (CID 65302623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).