C8H15NO4 — CID 65302588
4-[methoxy(methyl)amino]-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 65302588) has the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. Its IUPAC name is 4-[methoxy(methyl)amino]-2,2-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-[methoxy(methyl)amino]-2,2-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 65302588 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 4-[methoxy(methyl)amino]-2,2-dimethyl-4-oxobutanoic acid |
| SMILES | CON(C)C(=O)CC(C)(C)C(=O)O |
| InChI | InChI=1S/C8H15NO4/c1-8(2,7(11)12)5-6(10)9(3)13-4/h5H2,1-4H3,(H,11,12) |
| InChIKey | PXHDSUPHYXNFMS-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|