4-[butyl(2-hydroxyethyl)amino]-2,2-diethyl-4-oxobutanoic acid

C14H27NO4 — CID 54875034

IUPAC4-[butyl(2-hydroxyethyl)amino]-2,2-diethyl-4-oxobutanoic acid
SMILESCCCCN(CCO)C(=O)CC(CC)(CC)C(=O)O
InChIInChI=1S/C14H27NO4/c1-4-7-8-15(9-10-16)12(17)11-14(5-2,6-3)13(18)19/h16H,4-11H2,1-3H3,(H,18,19)
InChIKeyLCYXEDMVCDGXHY-UHFFFAOYSA-N
MW273.37 g/mol
LogP1.89
Rot. Bonds10

About 4-[butyl(2-hydroxyethyl)amino]-2,2-diethyl-4-oxobutanoic acid

4-[butyl(2-hydroxyethyl)amino]-2,2-diethyl-4-oxobutanoic acid (PubChem CID 54875034) has the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. Its IUPAC name is 4-[butyl(2-hydroxyethyl)amino]-2,2-diethyl-4-oxobutanoic acid.

Molecular Properties

Compound Name4-[butyl(2-hydroxyethyl)amino]-2,2-diethyl-4-oxobutanoic acid
PubChem CID54875034
Molecular FormulaC14H27NO4
Molecular Weight273.37 g/mol
Exact Mass273.19
IUPAC Name4-[butyl(2-hydroxyethyl)amino]-2,2-diethyl-4-oxobutanoic acid
SMILESCCCCN(CCO)C(=O)CC(CC)(CC)C(=O)O
InChIInChI=1S/C14H27NO4/c1-4-7-8-15(9-10-16)12(17)11-14(5-2,6-3)13(18)19/h16H,4-11H2,1-3H3,(H,18,19)
InChIKeyLCYXEDMVCDGXHY-UHFFFAOYSA-N
XLogP1.89
TPSA77.84 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds10
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.37
LogP ≤ 51.89
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-[butyl(2-hydroxyethyl)amino]-2,2-diethyl-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[butyl(2-hydroxyethyl)amino]-2,2-diethyl-4-oxobutanoic acid?
The IUPAC name of 4-[butyl(2-hydroxyethyl)amino]-2,2-diethyl-4-oxobutanoic acid (CID 54875034) is 4-[butyl(2-hydroxyethyl)amino]-2,2-diethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-[butyl(2-hydroxyethyl)amino]-2,2-diethyl-4-oxobutanoic acid?
The canonical SMILES for 4-[butyl(2-hydroxyethyl)amino]-2,2-diethyl-4-oxobutanoic acid is CCCCN(CCO)C(=O)CC(CC)(CC)C(=O)O.
What is the InChIKey of 4-[butyl(2-hydroxyethyl)amino]-2,2-diethyl-4-oxobutanoic acid?
The InChIKey is LCYXEDMVCDGXHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO4/c1-4-7-8-15(9-10-16)12(17)11-14(5-2,6-3)13(18)19/h16H,4-11H2,1-3H3,(H,18,19).
What are the key properties of 4-[butyl(2-hydroxyethyl)amino]-2,2-diethyl-4-oxobutanoic acid?
4-[butyl(2-hydroxyethyl)amino]-2,2-diethyl-4-oxobutanoic acid has a molecular weight of 273.37 g/mol, XLogP of 1.89, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[butyl(2-hydroxyethyl)amino]-2,2-diethyl-4-oxobutanoic acid is sourced from PubChem (CID 54875034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).