C17H33NO — CID 144603472
(Z)-2,2,4,4,7,7,8,8-octamethylnon-5-enamide (PubChem CID 144603472) has the molecular formula C17H33NO and a molecular weight of 267.46 g/mol. Its IUPAC name is (Z)-2,2,4,4,7,7,8,8-octamethylnon-5-enamide.
| Compound Name | (Z)-2,2,4,4,7,7,8,8-octamethylnon-5-enamide |
|---|---|
| PubChem CID | 144603472 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | (Z)-2,2,4,4,7,7,8,8-octamethylnon-5-enamide |
| SMILES | CC(C)(/C=C\C(C)(C)C(C)(C)C)CC(C)(C)C(N)=O |
| InChI | InChI=1S/C17H33NO/c1-14(2,3)17(8,9)11-10-15(4,5)12-16(6,7)13(18)19/h10-11H,12H2,1-9H3,(H2,18,19)/b11-10- |
| InChIKey | VICIHEZGMLSPFF-KHPPLWFESA-N |
| XLogP | 4.54 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|