C10H19NO2 — CID 176713396
2,2,4,4-tetramethyl-6-oxohexanamide (PubChem CID 176713396) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-6-oxohexanamide.
| Compound Name | 2,2,4,4-tetramethyl-6-oxohexanamide |
|---|---|
| PubChem CID | 176713396 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 2,2,4,4-tetramethyl-6-oxohexanamide |
| SMILES | CC(C)(CC=O)CC(C)(C)C(N)=O |
| InChI | InChI=1S/C10H19NO2/c1-9(2,5-6-12)7-10(3,4)8(11)13/h6H,5,7H2,1-4H3,(H2,11,13) |
| InChIKey | CMSJYLKTHOSXJH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|