C17H32N2O2 — CID 143714330
N'-[(E)-2,2-dimethylhex-4-enyl]-2,2,4,4-tetramethylpentanediamide (PubChem CID 143714330) has the molecular formula C17H32N2O2 and a molecular weight of 296.45 g/mol. Its IUPAC name is N'-[(E)-2,2-dimethylhex-4-enyl]-2,2,4,4-tetramethylpentanediamide.
| Compound Name | N'-[(E)-2,2-dimethylhex-4-enyl]-2,2,4,4-tetramethylpentanediamide |
|---|---|
| PubChem CID | 143714330 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | N'-[(E)-2,2-dimethylhex-4-enyl]-2,2,4,4-tetramethylpentanediamide |
| SMILES | C/C=C/CC(C)(C)CNC(=O)C(C)(C)CC(C)(C)C(N)=O |
| InChI | InChI=1S/C17H32N2O2/c1-8-9-10-15(2,3)12-19-14(21)17(6,7)11-16(4,5)13(18)20/h8-9H,10-12H2,1-7H3,(H2,18,20)(H,19,21)/b9-8+ |
| InChIKey | HJUSTSMLJWGZMN-CMDGGOBGSA-N |
| XLogP | 3.02 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|