C19H39NO — CID 178052138
2,2,4,4-tetramethyl-N-(2,2,3,3-tetramethylpentyl)hexanamide (PubChem CID 178052138) has the molecular formula C19H39NO and a molecular weight of 297.53 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-N-(2,2,3,3-tetramethylpentyl)hexanamide.
| Compound Name | 2,2,4,4-tetramethyl-N-(2,2,3,3-tetramethylpentyl)hexanamide |
|---|---|
| PubChem CID | 178052138 |
| Molecular Formula | C19H39NO |
| Molecular Weight | 297.53 g/mol |
| Exact Mass | 297.30 |
| IUPAC Name | 2,2,4,4-tetramethyl-N-(2,2,3,3-tetramethylpentyl)hexanamide |
| SMILES | CCC(C)(C)CC(C)(C)C(=O)NCC(C)(C)C(C)(C)CC |
| InChI | InChI=1S/C19H39NO/c1-11-16(3,4)13-17(5,6)15(21)20-14-19(9,10)18(7,8)12-2/h11-14H2,1-10H3,(H,20,21) |
| InChIKey | GANKBFMEXIHBEJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |