C10H20N2O2 — CID 19832795
2,2,3,3-tetramethylhexanediamide (PubChem CID 19832795) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2,2,3,3-tetramethylhexanediamide.
| Compound Name | 2,2,3,3-tetramethylhexanediamide |
|---|---|
| PubChem CID | 19832795 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 2,2,3,3-tetramethylhexanediamide |
| SMILES | CC(C)(CCC(N)=O)C(C)(C)C(N)=O |
| InChI | InChI=1S/C10H20N2O2/c1-9(2,6-5-7(11)13)10(3,4)8(12)14/h5-6H2,1-4H3,(H2,11,13)(H2,12,14) |
| InChIKey | VVQVYZDFZSCPSA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |