About butanediamide;molybdenum
butanediamide;molybdenum (PubChem CID 161333962) has the molecular formula C4H8MoN2O2
and a molecular weight of 212.06 g/mol. Its IUPAC name is butanediamide;molybdenum.
Molecular Properties
| Compound Name | butanediamide;molybdenum |
| PubChem CID | 161333962 |
| Molecular Formula | C4H8MoN2O2 |
| Molecular Weight | 212.06 g/mol |
| Exact Mass | 213.96 |
| IUPAC Name | butanediamide;molybdenum |
| SMILES | NC(=O)CCC(N)=O.[Mo] |
| InChI | InChI=1S/C4H8N2O2.Mo/c5-3(7)1-2-4(6)8;/h1-2H2,(H2,5,7)(H2,6,8); |
| InChIKey | VLUAWCKJGDPERL-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.06 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butanediamide;molybdenum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanediamide;molybdenum?
The IUPAC name of butanediamide;molybdenum (CID 161333962) is butanediamide;molybdenum.
What is the SMILES notation for butanediamide;molybdenum?
The canonical SMILES for butanediamide;molybdenum is NC(=O)CCC(N)=O.[Mo].
What is the InChIKey of butanediamide;molybdenum?
The InChIKey is VLUAWCKJGDPERL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O2.Mo/c5-3(7)1-2-4(6)8;/h1-2H2,(H2,5,7)(H2,6,8);.
What are the key properties of butanediamide;molybdenum?
butanediamide;molybdenum has a molecular weight of 212.06 g/mol, XLogP of -1.27, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanediamide;molybdenum is sourced from PubChem (CID 161333962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).