About butanediamide;ethane;molecular hydrogen
butanediamide;ethane;molecular hydrogen (PubChem CID 144732954) has the molecular formula C6H16N2O2
and a molecular weight of 148.21 g/mol. Its IUPAC name is butanediamide;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | butanediamide;ethane;molecular hydrogen |
| PubChem CID | 144732954 |
| Molecular Formula | C6H16N2O2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.12 |
| IUPAC Name | butanediamide;ethane;molecular hydrogen |
| SMILES | CC.NC(=O)CCC(N)=O.[H][H] |
| InChI | InChI=1S/C4H8N2O2.C2H6.H2/c5-3(7)1-2-4(6)8;1-2;/h1-2H2,(H2,5,7)(H2,6,8);1-2H3;1H |
| InChIKey | DUXZUVUJGDIMKP-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butanediamide;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanediamide;ethane;molecular hydrogen?
The IUPAC name of butanediamide;ethane;molecular hydrogen (CID 144732954) is butanediamide;ethane;molecular hydrogen.
What is the SMILES notation for butanediamide;ethane;molecular hydrogen?
The canonical SMILES for butanediamide;ethane;molecular hydrogen is CC.NC(=O)CCC(N)=O.[H][H].
What is the InChIKey of butanediamide;ethane;molecular hydrogen?
The InChIKey is DUXZUVUJGDIMKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O2.C2H6.H2/c5-3(7)1-2-4(6)8;1-2;/h1-2H2,(H2,5,7)(H2,6,8);1-2H3;1H.
What are the key properties of butanediamide;ethane;molecular hydrogen?
butanediamide;ethane;molecular hydrogen has a molecular weight of 148.21 g/mol, XLogP of 0.01, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanediamide;ethane;molecular hydrogen is sourced from PubChem (CID 144732954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).