About bis(butanediamide);sulfur dioxide
bis(butanediamide);sulfur dioxide (PubChem CID 175182532) has the molecular formula C8H16N4O6S
and a molecular weight of 296.31 g/mol. Its IUPAC name is bis(butanediamide);sulfur dioxide.
Molecular Properties
| Compound Name | bis(butanediamide);sulfur dioxide |
| PubChem CID | 175182532 |
| Molecular Formula | C8H16N4O6S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | bis(butanediamide);sulfur dioxide |
| SMILES | NC(=O)CCC(N)=O.NC(=O)CCC(N)=O.O=S=O |
| InChI | InChI=1S/2C4H8N2O2.O2S/c2*5-3(7)1-2-4(6)8;1-3-2/h2*1-2H2,(H2,5,7)(H2,6,8); |
| InChIKey | OUNLRIADTBXPNG-UHFFFAOYSA-N |
| XLogP | -3.20 |
| TPSA | 206.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(butanediamide);sulfur dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(butanediamide);sulfur dioxide?
The IUPAC name of bis(butanediamide);sulfur dioxide (CID 175182532) is bis(butanediamide);sulfur dioxide.
What is the SMILES notation for bis(butanediamide);sulfur dioxide?
The canonical SMILES for bis(butanediamide);sulfur dioxide is NC(=O)CCC(N)=O.NC(=O)CCC(N)=O.O=S=O.
What is the InChIKey of bis(butanediamide);sulfur dioxide?
The InChIKey is OUNLRIADTBXPNG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H8N2O2.O2S/c2*5-3(7)1-2-4(6)8;1-3-2/h2*1-2H2,(H2,5,7)(H2,6,8);.
What are the key properties of bis(butanediamide);sulfur dioxide?
bis(butanediamide);sulfur dioxide has a molecular weight of 296.31 g/mol, XLogP of -3.20, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(butanediamide);sulfur dioxide is sourced from PubChem (CID 175182532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).