About 4-oxopentanamide;titanium
4-oxopentanamide;titanium (PubChem CID 174475766) has the molecular formula C5H9NO2Ti
and a molecular weight of 163.00 g/mol. Its IUPAC name is 4-oxopentanamide;titanium.
Molecular Properties
| Compound Name | 4-oxopentanamide;titanium |
| PubChem CID | 174475766 |
| Molecular Formula | C5H9NO2Ti |
| Molecular Weight | 163.00 g/mol |
| Exact Mass | 163.01 |
| IUPAC Name | 4-oxopentanamide;titanium |
| SMILES | CC(=O)CCC(N)=O.[Ti] |
| InChI | InChI=1S/C5H9NO2.Ti/c1-4(7)2-3-5(6)8;/h2-3H2,1H3,(H2,6,8); |
| InChIKey | IJNAWGIUKLQQKD-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.00 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-oxopentanamide;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxopentanamide;titanium?
The IUPAC name of 4-oxopentanamide;titanium (CID 174475766) is 4-oxopentanamide;titanium.
What is the SMILES notation for 4-oxopentanamide;titanium?
The canonical SMILES for 4-oxopentanamide;titanium is CC(=O)CCC(N)=O.[Ti].
What is the InChIKey of 4-oxopentanamide;titanium?
The InChIKey is IJNAWGIUKLQQKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2.Ti/c1-4(7)2-3-5(6)8;/h2-3H2,1H3,(H2,6,8);.
What are the key properties of 4-oxopentanamide;titanium?
4-oxopentanamide;titanium has a molecular weight of 163.00 g/mol, XLogP of -0.16, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxopentanamide;titanium is sourced from PubChem (CID 174475766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).