C18H34O — CID 123537893
2,2,4,4,7,7,9,9-octamethyldec-5-enal (PubChem CID 123537893) has the molecular formula C18H34O and a molecular weight of 266.47 g/mol. Its IUPAC name is 2,2,4,4,7,7,9,9-octamethyldec-5-enal.
| Compound Name | 2,2,4,4,7,7,9,9-octamethyldec-5-enal |
|---|---|
| PubChem CID | 123537893 |
| Molecular Formula | C18H34O |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.26 |
| IUPAC Name | 2,2,4,4,7,7,9,9-octamethyldec-5-enal |
| SMILES | CC(C)(C)CC(C)(C)C=CC(C)(C)CC(C)(C)C=O |
| InChI | InChI=1S/C18H34O/c1-15(2,3)12-16(4,5)10-11-17(6,7)13-18(8,9)14-19/h10-11,14H,12-13H2,1-9H3 |
| InChIKey | RMUNYXCAAUHHBS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|