C14H30 — CID 142214554
methane;prop-1-ene;3,3,5,5-tetramethylhex-1-ene (PubChem CID 142214554) has the molecular formula C14H30 and a molecular weight of 198.39 g/mol. Its IUPAC name is methane;prop-1-ene;3,3,5,5-tetramethylhex-1-ene.
| Compound Name | methane;prop-1-ene;3,3,5,5-tetramethylhex-1-ene |
|---|---|
| PubChem CID | 142214554 |
| Molecular Formula | C14H30 |
| Molecular Weight | 198.39 g/mol |
| Exact Mass | 198.23 |
| IUPAC Name | methane;prop-1-ene;3,3,5,5-tetramethylhex-1-ene |
| SMILES | C.C=CC.C=CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C10H20.C3H6.CH4/c1-7-10(5,6)8-9(2,3)4;1-3-2;/h7H,1,8H2,2-6H3;3H,1H2,2H3;1H4 |
| InChIKey | FAHWHAGJFSKQTA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.39 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|