C15H25N3O3+2 — CID 20671748
carboxymethyl-dimethyl-[3-[[2-(4-methylpyridin-1-ium-1-yl)acetyl]amino]propyl]azanium (PubChem CID 20671748) has the molecular formula C15H25N3O3+2 and a molecular weight of 295.38 g/mol. Its IUPAC name is carboxymethyl-dimethyl-[3-[[2-(4-methylpyridin-1-ium-1-yl)acetyl]amino]propyl]azanium.
| Compound Name | carboxymethyl-dimethyl-[3-[[2-(4-methylpyridin-1-ium-1-yl)acetyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 20671748 |
| Molecular Formula | C15H25N3O3+2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | carboxymethyl-dimethyl-[3-[[2-(4-methylpyridin-1-ium-1-yl)acetyl]amino]propyl]azanium |
| SMILES | Cc1cc[n+](CC(=O)NCCC[N+](C)(C)CC(=O)O)cc1 |
| InChI | InChI=1S/C15H23N3O3/c1-13-5-8-17(9-6-13)11-14(19)16-7-4-10-18(2,3)12-15(20)21/h5-6,8-9H,4,7,10-12H2,1-3H3/p+2 |
| InChIKey | KDLAUDSVJOUGND-UHFFFAOYSA-P |
| XLogP | -0.05 |
| TPSA | 70.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|