C8H18N3O3+ — CID 134504205
3-(carbamoylamino)propyl-(carboxymethyl)-dimethylazanium (PubChem CID 134504205) has the molecular formula C8H18N3O3+ and a molecular weight of 204.25 g/mol. Its IUPAC name is 3-(carbamoylamino)propyl-(carboxymethyl)-dimethylazanium.
| Compound Name | 3-(carbamoylamino)propyl-(carboxymethyl)-dimethylazanium |
|---|---|
| PubChem CID | 134504205 |
| Molecular Formula | C8H18N3O3+ |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 3-(carbamoylamino)propyl-(carboxymethyl)-dimethylazanium |
| SMILES | C[N+](C)(CCCNC(N)=O)CC(=O)O |
| InChI | InChI=1S/C8H17N3O3/c1-11(2,6-7(12)13)5-3-4-10-8(9)14/h3-6H2,1-2H3,(H3-,9,10,12,13,14)/p+1 |
| InChIKey | DBAHYYAHLAZNLQ-UHFFFAOYSA-O |
| XLogP | -0.79 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|