C35H72N2O2 — CID 143661220
2-tert-butyl-N-hexyl-2,4,4-trimethylpentanamide;2-tert-butyl-2,4,4-trimethyl-N-pentylpentanamide (PubChem CID 143661220) has the molecular formula C35H72N2O2 and a molecular weight of 552.97 g/mol. Its IUPAC name is 2-tert-butyl-N-hexyl-2,4,4-trimethylpentanamide;2-tert-butyl-2,4,4-trimethyl-N-pentylpentanamide.
| Compound Name | 2-tert-butyl-N-hexyl-2,4,4-trimethylpentanamide;2-tert-butyl-2,4,4-trimethyl-N-pentylpentanamide |
|---|---|
| PubChem CID | 143661220 |
| Molecular Formula | C35H72N2O2 |
| Molecular Weight | 552.97 g/mol |
| Exact Mass | 552.56 |
| IUPAC Name | 2-tert-butyl-N-hexyl-2,4,4-trimethylpentanamide;2-tert-butyl-2,4,4-trimethyl-N-pentylpentanamide |
| SMILES | CCCCCCNC(=O)C(C)(CC(C)(C)C)C(C)(C)C.CCCCCNC(=O)C(C)(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H37NO.C17H35NO/c1-9-10-11-12-13-19-15(20)18(8,17(5,6)7)14-16(2,3)4;1-9-10-11-12-18-14(19)17(8,16(5,6)7)13-15(2,3)4/h9-14H2,1-8H3,(H,19,20);9-13H2,1-8H3,(H,18,19) |
| InChIKey | QGPILNRWZYYYNE-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.97 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|