C13H27N3O6S — CID 177425322
3-[3-[[(4S)-4-amino-4-carboxybutanoyl]amino]propyl-dimethylazaniumyl]propane-1-sulfonate (PubChem CID 177425322) has the molecular formula C13H27N3O6S and a molecular weight of 353.44 g/mol. Its IUPAC name is 3-[3-[[(4S)-4-amino-4-carboxybutanoyl]amino]propyl-dimethylazaniumyl]propane-1-sulfonate.
| Compound Name | 3-[3-[[(4S)-4-amino-4-carboxybutanoyl]amino]propyl-dimethylazaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 177425322 |
| Molecular Formula | C13H27N3O6S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 3-[3-[[(4S)-4-amino-4-carboxybutanoyl]amino]propyl-dimethylazaniumyl]propane-1-sulfonate |
| SMILES | C[N+](C)(CCCNC(=O)CC[C@H](N)C(=O)O)CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C13H27N3O6S/c1-16(2,9-4-10-23(20,21)22)8-3-7-15-12(17)6-5-11(14)13(18)19/h11H,3-10,14H2,1-2H3,(H2-,15,17,18,19,20,21,22)/t11-/m0/s1 |
| InChIKey | PNUZLWCQMNLJMY-NSHDSACASA-N |
| XLogP | -1.30 |
| TPSA | 149.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|