C7H14CuN2O7S — CID 174824189
copper;2-amino-5-(ethylamino)-5-oxopentanoic acid;sulfate (PubChem CID 174824189) has the molecular formula C7H14CuN2O7S and a molecular weight of 333.81 g/mol. Its IUPAC name is copper;2-amino-5-(ethylamino)-5-oxopentanoic acid;sulfate.
| Compound Name | copper;2-amino-5-(ethylamino)-5-oxopentanoic acid;sulfate |
|---|---|
| PubChem CID | 174824189 |
| Molecular Formula | C7H14CuN2O7S |
| Molecular Weight | 333.81 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | copper;2-amino-5-(ethylamino)-5-oxopentanoic acid;sulfate |
| SMILES | CCNC(=O)CCC(N)C(=O)O.O=S(=O)([O-])[O-].[Cu+2] |
| InChI | InChI=1S/C7H14N2O3.Cu.H2O4S/c1-2-9-6(10)4-3-5(8)7(11)12;;1-5(2,3)4/h5H,2-4,8H2,1H3,(H,9,10)(H,11,12);;(H2,1,2,3,4)/q;+2;/p-2 |
| InChIKey | KBULCFCEDHLLSP-UHFFFAOYSA-L |
| XLogP | -2.03 |
| TPSA | 172.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.81 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|