C7H14N2O3P+ — CID 175846430
[(2S)-2-amino-5-(ethylamino)-5-oxopentanoyl]-oxophosphanium (PubChem CID 175846430) has the molecular formula C7H14N2O3P+ and a molecular weight of 205.17 g/mol. Its IUPAC name is [(2S)-2-amino-5-(ethylamino)-5-oxopentanoyl]-oxophosphanium.
| Compound Name | [(2S)-2-amino-5-(ethylamino)-5-oxopentanoyl]-oxophosphanium |
|---|---|
| PubChem CID | 175846430 |
| Molecular Formula | C7H14N2O3P+ |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | [(2S)-2-amino-5-(ethylamino)-5-oxopentanoyl]-oxophosphanium |
| SMILES | CCNC(=O)CC[C@H](N)C(=O)[PH+]=O |
| InChI | InChI=1S/C7H13N2O3P/c1-2-9-6(10)4-3-5(8)7(11)13-12/h5H,2-4,8H2,1H3,(H,9,10)/p+1/t5-/m0/s1 |
| InChIKey | CZCXWKYMEMGMIQ-YFKPBYRVSA-O |
| XLogP | -0.22 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|