C10H19ClN2O4 — CID 175078520
2-amino-5-(ethylamino)-5-oxopentanoic acid;2-chloro-3-methyloxirane (PubChem CID 175078520) has the molecular formula C10H19ClN2O4 and a molecular weight of 266.72 g/mol. Its IUPAC name is 2-amino-5-(ethylamino)-5-oxopentanoic acid;2-chloro-3-methyloxirane.
| Compound Name | 2-amino-5-(ethylamino)-5-oxopentanoic acid;2-chloro-3-methyloxirane |
|---|---|
| PubChem CID | 175078520 |
| Molecular Formula | C10H19ClN2O4 |
| Molecular Weight | 266.72 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 2-amino-5-(ethylamino)-5-oxopentanoic acid;2-chloro-3-methyloxirane |
| SMILES | CC1OC1Cl.CCNC(=O)CCC(N)C(=O)O |
| InChI | InChI=1S/C7H14N2O3.C3H5ClO/c1-2-9-6(10)4-3-5(8)7(11)12;1-2-3(4)5-2/h5H,2-4,8H2,1H3,(H,9,10)(H,11,12);2-3H,1H3 |
| InChIKey | AGTFWPYPKDNBEU-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.72 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|