C7H15ClN2O3 — CID 73408744
2-amino-5-(ethylamino)-5-oxopentanoic acid;hydrochloride (PubChem CID 73408744) has the molecular formula C7H15ClN2O3 and a molecular weight of 210.66 g/mol. Its IUPAC name is 2-amino-5-(ethylamino)-5-oxopentanoic acid;hydrochloride.
| Compound Name | 2-amino-5-(ethylamino)-5-oxopentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 73408744 |
| Molecular Formula | C7H15ClN2O3 |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 2-amino-5-(ethylamino)-5-oxopentanoic acid;hydrochloride |
| SMILES | CCNC(=O)CCC(N)C(=O)O.Cl |
| InChI | InChI=1S/C7H14N2O3.ClH/c1-2-9-6(10)4-3-5(8)7(11)12;/h5H,2-4,8H2,1H3,(H,9,10)(H,11,12);1H |
| InChIKey | GPZPUVMAILBCED-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |