C16H26MgN4O10 — CID 139643109
magnesium bis(3-[[(4S)-4-amino-4-carboxybutanoyl]amino]propanoate) (PubChem CID 139643109) has the molecular formula C16H26MgN4O10 and a molecular weight of 458.71 g/mol. Its IUPAC name is magnesium bis(3-[[(4S)-4-amino-4-carboxybutanoyl]amino]propanoate).
| Compound Name | magnesium bis(3-[[(4S)-4-amino-4-carboxybutanoyl]amino]propanoate) |
|---|---|
| PubChem CID | 139643109 |
| Molecular Formula | C16H26MgN4O10 |
| Molecular Weight | 458.71 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | magnesium bis(3-[[(4S)-4-amino-4-carboxybutanoyl]amino]propanoate) |
| SMILES | N[C@@H](CCC(=O)NCCC(=O)[O-])C(=O)O.N[C@@H](CCC(=O)NCCC(=O)[O-])C(=O)O.[Mg+2] |
| InChI | InChI=1S/2C8H14N2O5.Mg/c2*9-5(8(14)15)1-2-6(11)10-4-3-7(12)13;/h2*5H,1-4,9H2,(H,10,11)(H,12,13)(H,14,15);/q;;+2/p-2/t2*5-;/m00./s1 |
| InChIKey | BNVWNUYDTDDTKE-MDTVQASCSA-L |
| XLogP | -5.51 |
| TPSA | 265.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.71 |
| LogP ≤ 5 | -5.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |