C10H17N3O6 — CID 173061748
2-amino-5-[[3-[carboxy(methyl)amino]-3-oxopropyl]amino]-5-oxopentanoic acid (PubChem CID 173061748) has the molecular formula C10H17N3O6 and a molecular weight of 275.26 g/mol. Its IUPAC name is 2-amino-5-[[3-[carboxy(methyl)amino]-3-oxopropyl]amino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[[3-[carboxy(methyl)amino]-3-oxopropyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 173061748 |
| Molecular Formula | C10H17N3O6 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-amino-5-[[3-[carboxy(methyl)amino]-3-oxopropyl]amino]-5-oxopentanoic acid |
| SMILES | CN(C(=O)O)C(=O)CCNC(=O)CCC(N)C(=O)O |
| InChI | InChI=1S/C10H17N3O6/c1-13(10(18)19)8(15)4-5-12-7(14)3-2-6(11)9(16)17/h6H,2-5,11H2,1H3,(H,12,14)(H,16,17)(H,18,19) |
| InChIKey | FTDRAOLYQPLWNT-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |