C19H32N4O10 — CID 58463544
2-amino-5-[2-[3-[2-[(4-amino-4-carboxybutanoyl)amino]ethoxy]-2,2-dimethyl-3-oxopropanoyl]oxyethylamino]-5-oxopentanoic acid (PubChem CID 58463544) has the molecular formula C19H32N4O10 and a molecular weight of 476.48 g/mol. Its IUPAC name is 2-amino-5-[2-[3-[2-[(4-amino-4-carboxybutanoyl)amino]ethoxy]-2,2-dimethyl-3-oxopropanoyl]oxyethylamino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[2-[3-[2-[(4-amino-4-carboxybutanoyl)amino]ethoxy]-2,2-dimethyl-3-oxopropanoyl]oxyethylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 58463544 |
| Molecular Formula | C19H32N4O10 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 2-amino-5-[2-[3-[2-[(4-amino-4-carboxybutanoyl)amino]ethoxy]-2,2-dimethyl-3-oxopropanoyl]oxyethylamino]-5-oxopentanoic acid |
| SMILES | CC(C)(C(=O)OCCNC(=O)CCC(N)C(=O)O)C(=O)OCCNC(=O)CCC(N)C(=O)O |
| InChI | InChI=1S/C19H32N4O10/c1-19(2,17(30)32-9-7-22-13(24)5-3-11(20)15(26)27)18(31)33-10-8-23-14(25)6-4-12(21)16(28)29/h11-12H,3-10,20-21H2,1-2H3,(H,22,24)(H,23,25)(H,26,27)(H,28,29) |
| InChIKey | XBGWKDDKWURXJZ-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 237.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|