C16H31N3O6 — CID 178180120
(2S)-2-amino-6-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]propanoylamino]hexanoic acid (PubChem CID 178180120) has the molecular formula C16H31N3O6 and a molecular weight of 361.44 g/mol. Its IUPAC name is (2S)-2-amino-6-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]propanoylamino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 178180120 |
| Molecular Formula | C16H31N3O6 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | (2S)-2-amino-6-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]propanoylamino]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCOCCC(=O)NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C16H31N3O6/c1-16(2,3)25-15(23)19-9-11-24-10-7-13(20)18-8-5-4-6-12(17)14(21)22/h12H,4-11,17H2,1-3H3,(H,18,20)(H,19,23)(H,21,22)/t12-/m0/s1 |
| InChIKey | QQNGQIOREBTJGK-LBPRGKRZSA-N |
| XLogP | 0.62 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|