C20H38N4O9 — CID 134198402
(2S)-6-[[2-[2-[2-[[2-[2-(2-acetamidoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetyl]amino]-2-aminohexanoic acid (PubChem CID 134198402) has the molecular formula C20H38N4O9 and a molecular weight of 478.54 g/mol. Its IUPAC name is (2S)-6-[[2-[2-[2-[[2-[2-(2-acetamidoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetyl]amino]-2-aminohexanoic acid.
| Compound Name | (2S)-6-[[2-[2-[2-[[2-[2-(2-acetamidoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetyl]amino]-2-aminohexanoic acid |
|---|---|
| PubChem CID | 134198402 |
| Molecular Formula | C20H38N4O9 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | (2S)-6-[[2-[2-[2-[[2-[2-(2-acetamidoethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetyl]amino]-2-aminohexanoic acid |
| SMILES | CC(=O)NCCOCCOCC(=O)NCCOCCOCC(=O)NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C20H38N4O9/c1-16(25)22-6-8-30-10-12-33-15-19(27)24-7-9-31-11-13-32-14-18(26)23-5-3-2-4-17(21)20(28)29/h17H,2-15,21H2,1H3,(H,22,25)(H,23,26)(H,24,27)(H,28,29)/t17-/m0/s1 |
| InChIKey | BGGGSQFBLZZXGB-KRWDZBQOSA-N |
| XLogP | -2.00 |
| TPSA | 187.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|