C21H41N4O8P — CID 144843670
N-[2-[2-[2-[2-[2-[2-[(5-amino-6-oxo-6-phosphanylhexyl)amino]-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxy]ethyl]propanamide (PubChem CID 144843670) has the molecular formula C21H41N4O8P and a molecular weight of 508.55 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[2-[2-[(5-amino-6-oxo-6-phosphanylhexyl)amino]-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxy]ethyl]propanamide.
| Compound Name | N-[2-[2-[2-[2-[2-[2-[(5-amino-6-oxo-6-phosphanylhexyl)amino]-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 144843670 |
| Molecular Formula | C21H41N4O8P |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | N-[2-[2-[2-[2-[2-[2-[(5-amino-6-oxo-6-phosphanylhexyl)amino]-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxy]ethyl]propanamide |
| SMILES | CCC(=O)NCCOCCOCC(=O)NCCOCCOCC(=O)NCCCCC(N)C(=O)P |
| InChI | InChI=1S/C21H41N4O8P/c1-2-18(26)24-7-9-30-11-14-33-16-20(28)25-8-10-31-12-13-32-15-19(27)23-6-4-3-5-17(22)21(29)34/h17H,2-16,22,34H2,1H3,(H,23,27)(H,24,26)(H,25,28) |
| InChIKey | BQCOGOAZFLSZTN-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 167.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|