C17H30BrN3O7 — CID 130368722
(2R)-6-[(2-bromoacetyl)amino]-2-[[2-[2-[2-(propanoylamino)ethoxy]ethoxy]acetyl]amino]hexanoic acid (PubChem CID 130368722) has the molecular formula C17H30BrN3O7 and a molecular weight of 468.35 g/mol. Its IUPAC name is (2R)-6-[(2-bromoacetyl)amino]-2-[[2-[2-[2-(propanoylamino)ethoxy]ethoxy]acetyl]amino]hexanoic acid.
| Compound Name | (2R)-6-[(2-bromoacetyl)amino]-2-[[2-[2-[2-(propanoylamino)ethoxy]ethoxy]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 130368722 |
| Molecular Formula | C17H30BrN3O7 |
| Molecular Weight | 468.35 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | (2R)-6-[(2-bromoacetyl)amino]-2-[[2-[2-[2-(propanoylamino)ethoxy]ethoxy]acetyl]amino]hexanoic acid |
| SMILES | CCC(=O)NCCOCCOCC(=O)N[C@H](CCCCNC(=O)CBr)C(=O)O |
| InChI | InChI=1S/C17H30BrN3O7/c1-2-14(22)20-7-8-27-9-10-28-12-16(24)21-13(17(25)26)5-3-4-6-19-15(23)11-18/h13H,2-12H2,1H3,(H,19,23)(H,20,22)(H,21,24)(H,25,26)/t13-/m1/s1 |
| InChIKey | XOYZGJTUMLEWQA-CYBMUJFWSA-N |
| XLogP | -0.20 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.35 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|