C24H42N4O13S — CID 88929681
2-[[2-[2-[2-[[4-carboxy-4-[(2-methyl-3-sulfopropanoyl)amino]butanoyl]amino]ethoxy]ethoxy]acetyl]amino]-6-(propanoylamino)hexanoic acid (PubChem CID 88929681) has the molecular formula C24H42N4O13S and a molecular weight of 626.68 g/mol. Its IUPAC name is 2-[[2-[2-[2-[[4-carboxy-4-[(2-methyl-3-sulfopropanoyl)amino]butanoyl]amino]ethoxy]ethoxy]acetyl]amino]-6-(propanoylamino)hexanoic acid.
| Compound Name | 2-[[2-[2-[2-[[4-carboxy-4-[(2-methyl-3-sulfopropanoyl)amino]butanoyl]amino]ethoxy]ethoxy]acetyl]amino]-6-(propanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 88929681 |
| Molecular Formula | C24H42N4O13S |
| Molecular Weight | 626.68 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | 2-[[2-[2-[2-[[4-carboxy-4-[(2-methyl-3-sulfopropanoyl)amino]butanoyl]amino]ethoxy]ethoxy]acetyl]amino]-6-(propanoylamino)hexanoic acid |
| SMILES | CCC(=O)NCCCCC(NC(=O)COCCOCCNC(=O)CCC(NC(=O)C(C)CS(=O)(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C24H42N4O13S/c1-3-19(29)25-9-5-4-6-17(23(33)34)27-21(31)14-41-13-12-40-11-10-26-20(30)8-7-18(24(35)36)28-22(32)16(2)15-42(37,38)39/h16-18H,3-15H2,1-2H3,(H,25,29)(H,26,30)(H,27,31)(H,28,32)(H,33,34)(H,35,36)(H,37,38,39) |
| InChIKey | KVVLXNJPQJHVTH-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 263.83 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.68 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|