C18H32N2O10 — CID 160531177
(2S)-2-amino-8-[2-[2-[2-[2-(carboxymethoxy)ethoxy]ethylamino]-2-oxoethoxy]ethoxy]-5-oxooctanoic acid (PubChem CID 160531177) has the molecular formula C18H32N2O10 and a molecular weight of 436.46 g/mol. Its IUPAC name is (2S)-2-amino-8-[2-[2-[2-[2-(carboxymethoxy)ethoxy]ethylamino]-2-oxoethoxy]ethoxy]-5-oxooctanoic acid.
| Compound Name | (2S)-2-amino-8-[2-[2-[2-[2-(carboxymethoxy)ethoxy]ethylamino]-2-oxoethoxy]ethoxy]-5-oxooctanoic acid |
|---|---|
| PubChem CID | 160531177 |
| Molecular Formula | C18H32N2O10 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | (2S)-2-amino-8-[2-[2-[2-[2-(carboxymethoxy)ethoxy]ethylamino]-2-oxoethoxy]ethoxy]-5-oxooctanoic acid |
| SMILES | N[C@@H](CCC(=O)CCCOCCOCC(=O)NCCOCCOCC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H32N2O10/c19-15(18(25)26)4-3-14(21)2-1-6-27-8-10-29-12-16(22)20-5-7-28-9-11-30-13-17(23)24/h15H,1-13,19H2,(H,20,22)(H,23,24)(H,25,26)/t15-/m0/s1 |
| InChIKey | QVOCHNLGUYDLNA-HNNXBMFYSA-N |
| XLogP | -1.21 |
| TPSA | 183.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|