C23H41FIN5O10 — CID 137436451
(2S)-2-amino-5-[2-[2-[2-[2-[2-[2-[[(5S)-5-(fluoroamino)-6-iodo-6-oxohexyl]amino]-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxy]ethylamino]-5-oxopentanoic acid (PubChem CID 137436451) has the molecular formula C23H41FIN5O10 and a molecular weight of 693.51 g/mol. Its IUPAC name is (2S)-2-amino-5-[2-[2-[2-[2-[2-[2-[[(5S)-5-(fluoroamino)-6-iodo-6-oxohexyl]amino]-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxy]ethylamino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-[2-[2-[2-[2-[2-[2-[[(5S)-5-(fluoroamino)-6-iodo-6-oxohexyl]amino]-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxy]ethylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 137436451 |
| Molecular Formula | C23H41FIN5O10 |
| Molecular Weight | 693.51 g/mol |
| Exact Mass | 693.19 |
| IUPAC Name | (2S)-2-amino-5-[2-[2-[2-[2-[2-[2-[[(5S)-5-(fluoroamino)-6-iodo-6-oxohexyl]amino]-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxy]ethylamino]-5-oxopentanoic acid |
| SMILES | N[C@@H](CCC(=O)NCCOCCOCC(=O)NCCOCCOCC(=O)NCCCC[C@H](NF)C(=O)I)C(=O)O |
| InChI | InChI=1S/C23H41FIN5O10/c24-30-18(22(25)34)3-1-2-6-27-20(32)15-39-13-12-38-10-8-29-21(33)16-40-14-11-37-9-7-28-19(31)5-4-17(26)23(35)36/h17-18,30H,1-16,26H2,(H,27,32)(H,28,31)(H,29,33)(H,35,36)/t17-,18-/m0/s1 |
| InChIKey | UJUPIHMOKFNMPS-ROUUACIJSA-N |
| XLogP | -1.43 |
| TPSA | 216.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.51 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|