C24H46N6O10 — CID 142518789
(2S)-2-amino-5-[2-[2-[2-[2-[2-[2-[[(5S)-5-hydrazinyl-6-oxoheptyl]amino]-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxy]ethylamino]-5-oxopentanoic acid (PubChem CID 142518789) has the molecular formula C24H46N6O10 and a molecular weight of 578.66 g/mol. Its IUPAC name is (2S)-2-amino-5-[2-[2-[2-[2-[2-[2-[[(5S)-5-hydrazinyl-6-oxoheptyl]amino]-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxy]ethylamino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-[2-[2-[2-[2-[2-[2-[[(5S)-5-hydrazinyl-6-oxoheptyl]amino]-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxy]ethylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 142518789 |
| Molecular Formula | C24H46N6O10 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.33 |
| IUPAC Name | (2S)-2-amino-5-[2-[2-[2-[2-[2-[2-[[(5S)-5-hydrazinyl-6-oxoheptyl]amino]-2-oxoethoxy]ethoxy]ethylamino]-2-oxoethoxy]ethoxy]ethylamino]-5-oxopentanoic acid |
| SMILES | CC(=O)[C@H](CCCCNC(=O)COCCOCCNC(=O)COCCOCCNC(=O)CC[C@H](N)C(=O)O)NN |
| InChI | InChI=1S/C24H46N6O10/c1-18(31)20(30-26)4-2-3-7-27-22(33)16-39-14-13-38-11-9-29-23(34)17-40-15-12-37-10-8-28-21(32)6-5-19(25)24(35)36/h19-20,30H,2-17,25-26H2,1H3,(H,27,33)(H,28,32)(H,29,34)(H,35,36)/t19-,20-/m0/s1 |
| InChIKey | MVUJQVBVDHYHQD-PMACEKPBSA-N |
| XLogP | -2.82 |
| TPSA | 242.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|