C7H14N3O7+ — CID 123503201
2-[(4-amino-4-carboxybutanoyl)amino]ethylperoxy-hydroxy-oxoazanium (PubChem CID 123503201) has the molecular formula C7H14N3O7+ and a molecular weight of 252.20 g/mol. Its IUPAC name is 2-[(4-amino-4-carboxybutanoyl)amino]ethylperoxy-hydroxy-oxoazanium.
| Compound Name | 2-[(4-amino-4-carboxybutanoyl)amino]ethylperoxy-hydroxy-oxoazanium |
|---|---|
| PubChem CID | 123503201 |
| Molecular Formula | C7H14N3O7+ |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 2-[(4-amino-4-carboxybutanoyl)amino]ethylperoxy-hydroxy-oxoazanium |
| SMILES | NC(CCC(=O)NCCOO[N+](=O)O)C(=O)O |
| InChI | InChI=1S/C7H13N3O7/c8-5(7(12)13)1-2-6(11)9-3-4-16-17-10(14)15/h5H,1-4,8H2,(H2-,9,11,12,13,14,15)/p+1 |
| InChIKey | CTWJUKFVDUWXBZ-UHFFFAOYSA-O |
| XLogP | -1.67 |
| TPSA | 151.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|