C10H20N2O3 — CID 79204974
N-[3-(dimethylamino)-3-oxopropyl]-4-hydroxypentanamide (PubChem CID 79204974) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is N-[3-(dimethylamino)-3-oxopropyl]-4-hydroxypentanamide.
| Compound Name | N-[3-(dimethylamino)-3-oxopropyl]-4-hydroxypentanamide |
|---|---|
| PubChem CID | 79204974 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | N-[3-(dimethylamino)-3-oxopropyl]-4-hydroxypentanamide |
| SMILES | CC(O)CCC(=O)NCCC(=O)N(C)C |
| InChI | InChI=1S/C10H20N2O3/c1-8(13)4-5-9(14)11-7-6-10(15)12(2)3/h8,13H,4-7H2,1-3H3,(H,11,14) |
| InChIKey | CSUNHMHRANZYQJ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |