C12H24N2O3 — CID 79192929
N-[3-(butan-2-ylamino)-3-oxopropyl]-4-hydroxypentanamide (PubChem CID 79192929) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is N-[3-(butan-2-ylamino)-3-oxopropyl]-4-hydroxypentanamide.
| Compound Name | N-[3-(butan-2-ylamino)-3-oxopropyl]-4-hydroxypentanamide |
|---|---|
| PubChem CID | 79192929 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | N-[3-(butan-2-ylamino)-3-oxopropyl]-4-hydroxypentanamide |
| SMILES | CCC(C)NC(=O)CCNC(=O)CCC(C)O |
| InChI | InChI=1S/C12H24N2O3/c1-4-9(2)14-12(17)7-8-13-11(16)6-5-10(3)15/h9-10,15H,4-8H2,1-3H3,(H,13,16)(H,14,17) |
| InChIKey | MYMVJPHXCREBLC-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |