C12H24N4O3 — CID 143230381
2-amino-N-[3-(butan-2-ylamino)-3-oxopropyl]pentanediamide (PubChem CID 143230381) has the molecular formula C12H24N4O3 and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-amino-N-[3-(butan-2-ylamino)-3-oxopropyl]pentanediamide.
| Compound Name | 2-amino-N-[3-(butan-2-ylamino)-3-oxopropyl]pentanediamide |
|---|---|
| PubChem CID | 143230381 |
| Molecular Formula | C12H24N4O3 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 2-amino-N-[3-(butan-2-ylamino)-3-oxopropyl]pentanediamide |
| SMILES | CCC(C)NC(=O)CCNC(=O)C(N)CCC(N)=O |
| InChI | InChI=1S/C12H24N4O3/c1-3-8(2)16-11(18)6-7-15-12(19)9(13)4-5-10(14)17/h8-9H,3-7,13H2,1-2H3,(H2,14,17)(H,15,19)(H,16,18) |
| InChIKey | QYHOOZKROODBPI-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |